Product Name | D-Sorbitol,D-Glucitol |
---|---|
CAS | 26566-34-7 |
Formula | C6H14O6 |
MW | 182.17 |
Appearance | white powder |
Melting point | 93℃(lit.) |
Boiling point | 494.9 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | D-Sorbitol,D-Glucitol |
---|---|
CAS | 26566-34-7 |
Formula | C6H14O6 |
MW | 182.17 |
Appearance | white powder |
Melting point | 93℃(lit.) |
Boiling point | 494.9 °C(lit.) |
CAS | 26566-34-7 |
---|---|
Formula | C6H14O6 |
MW | 182.17 |
Appearance | white powder |
Melting point | 93℃(lit.) |
Boiling point | 494.9 °C(lit.) |
Water Solubility | 235g/100g |
特性 | * |
Smiles | C([CH]([CH]([CH]([CH](CO)O)O)O)O)O |
InchiKey | FBPFZTCFMRRESA-UHFFFAOYSA-N |