Product Name | alpha-L-Xylopyranose |
---|---|
CAS | 7296-58-4 |
Formula | C5 H10 O5 |
MW | 150.1299 |
MDL | MFCD09841838 |
Boiling point | 333.2±42.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | alpha-L-Xylopyranose |
---|---|
CAS | 7296-58-4 |
Formula | C5 H10 O5 |
MW | 150.1299 |
MDL | MFCD09841838 |
Boiling point | 333.2±42.0 °C(Predicted) |
CAS | 7296-58-4 |
---|---|
Formula | C5 H10 O5 |
MW | 150.1299 |
MDL | MFCD09841838 |
Boiling point | 333.2±42.0 °C(Predicted) |
特性 | * |
Smiles | C1[CH]([CH]([CH]([CH](O1)O)O)O)O |
InchiKey | SRBFZHDQGSBBOR-UHFFFAOYSA-N |