Product Name | Methyl-4,6-O-benzylidene-2,3-di-O-tosyl-alpha-D-glucopyranoside |
---|---|
CAS | 6884-01-1 |
Formula | C28 H30 O10 S2 |
MW | 590.66 |
MDL | MFCD00051215 |
Melting point | 148-149 °C |
Boiling point | 737.8±60.0 °C(Predicted) |
Storage condition | -20°C Freezer |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-4,6-O-benzylidene-2,3-di-O-tosyl-alpha-D-glucopyranoside |
---|---|
CAS | 6884-01-1 |
Formula | C28 H30 O10 S2 |
MW | 590.66 |
MDL | MFCD00051215 |
Melting point | 148-149 °C |
Boiling point | 737.8±60.0 °C(Predicted) |
Storage condition | -20°C Freezer |
CAS | 6884-01-1 |
---|---|
Formula | C28 H30 O10 S2 |
MW | 590.66 |
MDL | MFCD00051215 |
Melting point | 148-149 °C |
Boiling point | 737.8±60.0 °C(Predicted) |
Storage | -20°C Freezer |
Smiles | O([C@@H]1[C@H]([C@@H](OC)O[C@]2([H])COC(C3C=CC=CC=3)O[C@@]12[H])OS(C1C=CC(C)=CC=1)(=O)=O)S(C1C=CC(C)=CC=1)(=O)=O |&1:1,2,3,7,19,r| |
InchiKey | MPNMHFPNHIKNOA-YNRNLHMGNA-N |