Chinese alias | PMEA, GS-393, GS 0393, P-[[2-(6-Amino-9H-purin-9-yl)ethoxy]methyl]phosphonic acid, 9-(2-phosphonylme |
CAS | 106941-25-7 |
Formula | C8H12N5O4P |
MW | 273.19 |
Appearance | white to beige powder |
MDL | MFCD00866943 |
Melting point | 301 °C |
Boiling point | 260°C |
Storage condition | desiccated −20°C |
Safe Property | S26 |
Hazard Category Code | R36/37/38:Irritating to eyes, respiratory system and skin . |
Water Solubility | 0.1 M NaOH: ≥5 mg/mL |
Storage | desiccated −20°C |
Smiles | C(COCP(=O)(O)O)N1C=2C(N=C1)=C(N)N=CN2 |
InchiKey | SUPKOOSCJHTBAH-UHFFFAOYSA-N |