| Product Name | (3-((4-methoxybenzyl)carbamoyl)phenyl)boronic acid |
|---|---|
| CAS | 874288-15-0 |
| Formula | C15 H16 B N O4 |
| MW | 285.1 |
Product Center
MF:
C15 H16 B N O4
MW:
285.1
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB50381 | yunbang | 1g | 95+% | $543.33 | Visible after login | Inquiry |
| Product Name | (3-((4-methoxybenzyl)carbamoyl)phenyl)boronic acid |
|---|---|
| CAS | 874288-15-0 |
| Formula | C15 H16 B N O4 |
| MW | 285.1 |
| CAS | 874288-15-0 |
|---|---|
| Formula | C15 H16 B N O4 |
| MW | 285.1 |
| Smiles | OB(C1C=CC=C(C(=O)NCC2C=CC(OC)=CC=2)C=1)O |
| InchiKey | WJHSWLXHDJCBAY-UHFFFAOYSA-N |