| Product Name | Boronic acid, [3-[(dibutylamino)carbonyl]phenyl]- (9CI) |
|---|---|
| CAS | 397843-72-0 |
| Formula | C15 H24 B N O3 |
| MW | 277.17 |
Product Center
MF:
C15 H24 B N O3
MW:
277.17
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB50370 | yunbang | 1g | 95% | $566.67 | Visible after login | Inquiry |
| Product Name | Boronic acid, [3-[(dibutylamino)carbonyl]phenyl]- (9CI) |
|---|---|
| CAS | 397843-72-0 |
| Formula | C15 H24 B N O3 |
| MW | 277.17 |
| CAS | 397843-72-0 |
|---|---|
| Formula | C15 H24 B N O3 |
| MW | 277.17 |
| Smiles | OB(C1C=CC=C(C(=O)N(CCCC)CCCC)C=1)O |
| InchiKey | UEUNTIZOTIFCJK-UHFFFAOYSA-N |