| Product Name | (S)-3-(4-methoxyphenyl)-beta-alaninol |
|---|---|
| CAS | 886061-27-4 |
| Formula | C10H15NO2 |
| MW | 181.235 |
| Boiling point | 334.2 |
Product Center
MF:
C10H15NO2
MW:
181.235
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB50207 | yunbang | 1g | 97% | $275.00 | Visible after login | Inquiry |
| Product Name | (S)-3-(4-methoxyphenyl)-beta-alaninol |
|---|---|
| CAS | 886061-27-4 |
| Formula | C10H15NO2 |
| MW | 181.235 |
| Boiling point | 334.2 |
| CAS | 886061-27-4 |
|---|---|
| Formula | C10H15NO2 |
| MW | 181.235 |
| Boiling point | 334.2 |
| Smiles | OCC[C@@H](C1C=CC(OC)=CC=1)N |
| InchiKey | WHWMCHUIUINGOD-JTQLQIEISA-N |