Product Name | 4,6-Dimethyldibenzothiophene |
---|---|
Chinese alias | 4,6-DMDBT |
CAS | 1207-12-1 |
Formula | C14H12S |
MW | 212.31 |
Appearance | light yellow to light brown crystalline solid |
MDL | MFCD00216264 |
Melting point | 153-157 °C |
Boiling point | 340 °C (approx) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
YB46095 | yunbang | 250mg | 95% | $8.33 | Visible after login | Inquiry | ||
YB46095 | yunbang | 1g | 95% | $18.33 | Visible after login | Inquiry | ||
YB46095 | yunbang | 5g | 95% | $90.00 | Visible after login | Inquiry | ||
YB46095 | yunbang | 25g | 95% | $386.67 | Visible after login | Inquiry |
Product Name | 4,6-Dimethyldibenzothiophene |
---|---|
Chinese alias | 4,6-DMDBT |
CAS | 1207-12-1 |
Formula | C14H12S |
MW | 212.31 |
Appearance | light yellow to light brown crystalline solid |
MDL | MFCD00216264 |
Melting point | 153-157 °C |
Boiling point | 340 °C (approx) |
Symbol | N/A |
---|---|
Safe Property | S24/25 |
Chinese alias | 4,6-DMDBT |
---|---|
CAS | 1207-12-1 |
Formula | C14H12S |
MW | 212.31 |
Appearance | light yellow to light brown crystalline solid |
MDL | MFCD00216264 |
Melting point | 153-157 °C |
Boiling point | 340 °C (approx) |
Safe Property | S24/25 |
Water Solubility | 微溶 |
Smiles | CC1=C2C(C=3C(S2)=C(C)C=CC3)=CC=C1 |
InchiKey | MYAQZIAVOLKEGW-UHFFFAOYSA-N |