| Chinese alias | Sertraline Hydrochloride - CAS 79559-97-0 - Calbiochem, Serotonin (5-HT) Reuptake Inhibitor, Sertral |
|---|
| CAS | 79559-97-0 |
|---|
| Formula | C17H17Cl2N.ClH |
|---|
| MW | 306.23 (free base basis) |
|---|
| Appearance | white solid |
|---|
| MDL | MFCD00895772 |
|---|
| Melting point | 243-245 °C |
|---|
| Boiling point | 416.3ºC at 760 mmHg |
|---|
| Storage condition | OK to freezeprotect from light 2-8°C |
|---|
| Safe Property | S22-24/25-36-26-45-36/37-16-7 |
|---|
| Hazard Category Code | R36/37/38-39/23/24/25-23/24/25-11 |
|---|
| Water Solubility | DMSO: 100 mMethanol: 50 mM |
|---|
| Storage | OK to freezeprotect from light 2-8°C |
|---|
| Smiles | N(C)[C@@H]1C=2C([C@@H](CC1)C3=CC(Cl)=C(Cl)C=C3)=CC=CC2.Cl |
|---|
| InchiKey | BLFQGGGGFNSJKA-XHXSRVRCSA-N |
|---|
