Product Name | PTH-TYROSINE |
---|---|
CAS | 4332-95-0 |
Formula | C16 H14 N2 O2 S |
MW | 298.36 |
MDL | MFCD00027415 |
Melting point | 217.0 to 225.0 °C |
Boiling point | 467.2±37.0 °C(Predicted) |
Storage condition | −20°C |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
YB126135 | yunbang | 100mg | 98% | $8.33 | Visible after login | In stock |
Product Name | PTH-TYROSINE |
---|---|
CAS | 4332-95-0 |
Formula | C16 H14 N2 O2 S |
MW | 298.36 |
MDL | MFCD00027415 |
Melting point | 217.0 to 225.0 °C |
Boiling point | 467.2±37.0 °C(Predicted) |
Storage condition | −20°C |
CAS | 4332-95-0 |
---|---|
Formula | C16 H14 N2 O2 S |
MW | 298.36 |
MDL | MFCD00027415 |
Melting point | 217.0 to 225.0 °C |
Boiling point | 467.2±37.0 °C(Predicted) |
Storage | −20°C |
Smiles | C1(=S)NC(CC2=CC=C(O)C=C2)C(=O)N1C1=CC=CC=C1 |
InchiKey | LCFDDJINTNHAEQ-UHFFFAOYSA-N |