Product Name | 4-Methylumbelliferyl-β-D-cellotrioside |
---|---|
CAS | 84325-19-9 |
Formula | C34 H48 O23 |
MW | 824.73 |
MDL | MFCD02094283 |
Melting point | 309-311°C |
Boiling point | 1148.7±65.0 °C(Predicted) |
Storage condition | Refrigerator |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 4-Methylumbelliferyl-β-D-cellotrioside |
---|---|
CAS | 84325-19-9 |
Formula | C34 H48 O23 |
MW | 824.73 |
MDL | MFCD02094283 |
Melting point | 309-311°C |
Boiling point | 1148.7±65.0 °C(Predicted) |
Storage condition | Refrigerator |
CAS | 84325-19-9 |
---|---|
Formula | C34 H48 O23 |
MW | 824.73 |
MDL | MFCD02094283 |
Melting point | 309-311°C |
Boiling point | 1148.7±65.0 °C(Predicted) |
Storage condition | Refrigerator |
Storage | Refrigerator |
Smiles | O[C@@H]1C(CO)O[C@@H](O[C@@H]2C(CO)O[C@@H](O[C@@H]3C(CO)O[C@@H](O[C@@H]4C(CO)O[C@@H](OC5C=C6OC(=O)C=C(C)C6=CC=5)C(O)[C@H]4O)C(O)[C@H]3O)C(O)[C@H]2O)C(O)[C@H]1O |
InchiKey | VLSZKXHJJYJMLH-VTVLNYHISA-N |