Product Name | N1-Methyl-2'-deoxyadenosine |
---|---|
CAS | 60192-55-4 |
Formula | C11 H15 N5 O3 |
MW | 265.27 |
Appearance | white to off white solid |
MDL | MFCD00055999 |
Boiling point | 609.7±65.0 °C |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | N1-Methyl-2'-deoxyadenosine |
---|---|
CAS | 60192-55-4 |
Formula | C11 H15 N5 O3 |
MW | 265.27 |
Appearance | white to off white solid |
MDL | MFCD00055999 |
Boiling point | 609.7±65.0 °C |
Symbol |
---|
CAS | 60192-55-4 |
---|---|
Formula | C11 H15 N5 O3 |
MW | 265.27 |
Appearance | white to off white solid |
MDL | MFCD00055999 |
Boiling point | 609.7±65.0 °C |
特性 | * |
Smiles | CN1C=NC2=C(C1=N)N=CN2[CH]3C[CH]([CH](O3)CO)O |
InchiKey | AYVJNJNKPVUEGT-UHFFFAOYSA-N |