Product Name | 3,4,6-Tri-O-acetyl-2-deoxy-D-galactocopyranose |
---|---|
CAS | 69503-96-4 |
Formula | C12H18O8 |
MW | 290.27 |
Boiling point | 415.9±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 3,4,6-Tri-O-acetyl-2-deoxy-D-galactocopyranose |
---|---|
CAS | 69503-96-4 |
Formula | C12H18O8 |
MW | 290.27 |
Boiling point | 415.9±45.0 °C(lit.) |
Symbol |
![]() |
---|
CAS | 69503-96-4 |
---|---|
Formula | C12H18O8 |
MW | 290.27 |
Boiling point | 415.9±45.0 °C(lit.) |
特性 | * |
Smiles | O=CC[CH](OC(=O)C)[CH](OC(=O)C)[CH](COC(=O)C)O |
InchiKey | HSSANCDQNZBMCX-UHFFFAOYSA-N |