Product Name | 1-Bromo-2-O,3-O,4-O,6-O-tetrabenzoyl-1-deoxy-α-D-mannopyranose |
---|---|
CAS | 14218-30-5 |
Formula | C34H27BrO9 |
MW | 659.48 |
Boiling point | 729.9±60.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1-Bromo-2-O,3-O,4-O,6-O-tetrabenzoyl-1-deoxy-α-D-mannopyranose |
---|---|
CAS | 14218-30-5 |
Formula | C34H27BrO9 |
MW | 659.48 |
Boiling point | 729.9±60.0 °C(lit.) |
CAS | 14218-30-5 |
---|---|
Formula | C34H27BrO9 |
MW | 659.48 |
Boiling point | 729.9±60.0 °C(lit.) |
特性 | * |
Smiles | C(OC)(=O)C1=CC=CC=C1[CH]1[CH](OC(=O)C2=CC=CC=C2)[CH](OC(=O)C2=CC=CC=C2)[CH](OC(=O)C2=CC=CC=C2)[CH](Br)O1 |
InchiKey | YPNRLYRLEZEEAH-UHFFFAOYSA-N |