Product Name | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose |
---|---|
CAS | 4291-69-4 |
Formula | C34 H36 O6 |
MW | 540.65 |
MDL | MFCD00191026 |
Melting point | 152 °C |
Boiling point | 672.4±55.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose |
---|---|
CAS | 4291-69-4 |
Formula | C34 H36 O6 |
MW | 540.65 |
MDL | MFCD00191026 |
Melting point | 152 °C |
Boiling point | 672.4±55.0 °C(Predicted) |
CAS | 4291-69-4 |
---|---|
Formula | C34 H36 O6 |
MW | 540.65 |
MDL | MFCD00191026 |
Melting point | 152 °C |
Boiling point | 672.4±55.0 °C(Predicted) |
Smiles | [C@@H]1(OCC2=CC=CC=C2)[C@@H](OCC2=CC=CC=C2)C(O[C@H](COCC2C=CC=CC=2)[C@@H]1OCC1=CC=CC=C1)O |&1:0,9,20,30,r| |
InchiKey | OGOMAWHSXRDAKZ-VVNYRLIGNA-N |