Product Name | beta-D-Allofuranose |
---|---|
CAS | 36468-80-1 |
Formula | C6 H12 O6 |
MW | 180.16 |
Boiling point | 476.9±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | beta-D-Allofuranose |
---|---|
CAS | 36468-80-1 |
Formula | C6 H12 O6 |
MW | 180.16 |
Boiling point | 476.9±45.0 °C(lit.) |
CAS | 36468-80-1 |
---|---|
Formula | C6 H12 O6 |
MW | 180.16 |
Boiling point | 476.9±45.0 °C(lit.) |
特性 | * |
Smiles | C([C@H]([C@@H]1[C@H]([C@H]([C@@H](O1)O)O)O)O)O |
InchiKey | AVVWPBAENSWJCB-AIECOIEWSA-N |