| Product Name | AristolochicAcidA |
|---|---|
| Chinese alias | TR 1736 |
| CAS | 313-67-7 |
| Formula | C17H11NO7 |
| MW | 341.27 |
| Appearance | yellow powder |
| MDL | MFCD00004996 |
| Melting point | 278 °C (decomp) |
| Boiling point | 260 °C |
| Storage condition | 2-8°C |
Product Center
MF:
C17H11NO7
MW:
341.27
Characters:yellow powder
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | AristolochicAcidA |
|---|---|
| Chinese alias | TR 1736 |
| CAS | 313-67-7 |
| Formula | C17H11NO7 |
| MW | 341.27 |
| Appearance | yellow powder |
| MDL | MFCD00004996 |
| Melting point | 278 °C (decomp) |
| Boiling point | 260 °C |
| Storage condition | 2-8°C |
| Symbol | N/A |
|---|---|
| Safe Property | S7-S35-S45 |
| Hazard Category Code | R25 |
| Chinese alias | TR 1736 |
|---|---|
| CAS | 313-67-7 |
| Formula | C17H11NO7 |
| MW | 341.27 |
| Appearance | yellow powder |
| MDL | MFCD00004996 |
| Melting point | 278 °C (decomp) |
| Boiling point | 260 °C |
| Safe Property | S7-S35-S45 |
| Hazard Category Code | R25 |
| Water Solubility | DMSO: solubleethanol: soluble |
| 运输要求 | 室温 |
| Storage | 2-8°C |
| Smiles | N(C1C2C(=C3OCOC3=CC=2C(=O)O)C2C(=C(C=CC=2)OC)C=1)(=O)=O |
| InchiKey | BBFQZRXNYIEMAW-UHFFFAOYSA-N |