Product Name | Methyl-6-azido-6-deoxy-α-Dgalactopyranoside |
---|---|
CAS | 18908-43-5 |
Formula | C7 H13 N3 O5 |
MW | 219.20 |
Melting point | 173.8-174.1 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-6-azido-6-deoxy-α-Dgalactopyranoside |
---|---|
CAS | 18908-43-5 |
Formula | C7 H13 N3 O5 |
MW | 219.20 |
Melting point | 173.8-174.1 °C(lit.) |
CAS | 18908-43-5 |
---|---|
Formula | C7 H13 N3 O5 |
MW | 219.20 |
Melting point | 173.8-174.1 °C(lit.) |
特性 | * |
Smiles | C([CH]1[CH]([CH](O)[CH](O)[CH](OC)O1)O)N=[N+]=[N-] |
InchiKey | DITZTAYZVSZBCC-UHFFFAOYSA-N |