Product Name | 2,3,4,6,2',3',6'-Hepta-O-acetyl-α-Cellobiosyl azide |
---|---|
CAS | 133321-47-8 |
Formula | C26H35N3O17 |
MW | 661.57 |
Melting point | 196-198 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 2,3,4,6,2',3',6'-Hepta-O-acetyl-α-Cellobiosyl azide |
---|---|
CAS | 133321-47-8 |
Formula | C26H35N3O17 |
MW | 661.57 |
Melting point | 196-198 °C(lit.) |
CAS | 133321-47-8 |
---|---|
Formula | C26H35N3O17 |
MW | 661.57 |
Melting point | 196-198 °C(lit.) |
特性 | * |
Smiles | O([C]1([H])O[CH](COC(=O)C)[CH](OC(=O)C)[CH](OC(=O)C)[CH]1OC(=O)C)[CH]1[CH](O[CH](N=[N+]=[N-])[CH](OC(=O)C)[CH]1OC(=O)C)COC(=O)C |
InchiKey | JFCQZWVIHHPJTD-UHFFFAOYSA-N |