Product Name | 2,3,4-Tri-O-acetyl-6-O-tosyl-α-D-galactopyranosyl bromide |
---|---|
CAS | 13046-90-7 |
Formula | C19H23BrO10S |
MW | 523.35 |
Melting point | 147 °C(lit.) |
Boiling point | 556.5±50.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 2,3,4-Tri-O-acetyl-6-O-tosyl-α-D-galactopyranosyl bromide |
---|---|
CAS | 13046-90-7 |
Formula | C19H23BrO10S |
MW | 523.35 |
Melting point | 147 °C(lit.) |
Boiling point | 556.5±50.0 °C(lit.) |
CAS | 13046-90-7 |
---|---|
Formula | C19H23BrO10S |
MW | 523.35 |
Melting point | 147 °C(lit.) |
Boiling point | 556.5±50.0 °C(lit.) |
特性 | * |
Smiles | O([CH]1[CH]([CH](Br)O[CH](COS(C2C=CC(C)=CC=2)(=O)=O)[CH]1OC(=O)C)OC(=O)C)C(=O)C |
InchiKey | QEJSZXDTRCRCHO-UHFFFAOYSA-N |