Product Name | α-2,3,4,6-Tetra-O-benzyl-D-galactopyranosyl fluoride |
---|---|
CAS | 94898-43-8 |
Formula | C34H35FO5 |
MW | 542.64 |
Boiling point | 639.4±55.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | α-2,3,4,6-Tetra-O-benzyl-D-galactopyranosyl fluoride |
---|---|
CAS | 94898-43-8 |
Formula | C34H35FO5 |
MW | 542.64 |
Boiling point | 639.4±55.0 °C(lit.) |
CAS | 94898-43-8 |
---|---|
Formula | C34H35FO5 |
MW | 542.64 |
Boiling point | 639.4±55.0 °C(lit.) |
特性 | * |
Smiles | C1(F)O[CH](COCC2=CC=CC=C2)[CH](OCC2=CC=CC=C2)[CH](OCC2=CC=CC=C2)[CH]1OCC1=CC=CC=C1 |
InchiKey | QNXIKNZDQVSBCO-UHFFFAOYSA-N |