Product Name | 1-Thio-β-D-galactose |
---|---|
CAS | 49858-49-3 |
Formula | C6 H12 O5 S |
MW | 196.22 |
MDL | MFCD18643143 |
Melting point | 100-102 °C(lit.) |
Boiling point | 432.6±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1-Thio-β-D-galactose |
---|---|
CAS | 49858-49-3 |
Formula | C6 H12 O5 S |
MW | 196.22 |
MDL | MFCD18643143 |
Melting point | 100-102 °C(lit.) |
Boiling point | 432.6±45.0 °C(lit.) |
CAS | 49858-49-3 |
---|---|
Formula | C6 H12 O5 S |
MW | 196.22 |
MDL | MFCD18643143 |
Melting point | 100-102 °C(lit.) |
Boiling point | 432.6±45.0 °C(lit.) |
特性 | * |
Smiles | S[CH]1O[CH](CO)[CH](O)[CH](O)[CH]1O |
InchiKey | JUSMHIGDXPKSID-UHFFFAOYSA-N |