Product Name | 2,3:4,5-Di-O-isopropylidene-D-xylitol |
---|---|
CAS | 30737-85-0 |
Formula | C11H20O5 |
MW | 232.27 |
MDL | MFCD00070333 |
Boiling point | 300.1±37.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 2,3:4,5-Di-O-isopropylidene-D-xylitol |
---|---|
CAS | 30737-85-0 |
Formula | C11H20O5 |
MW | 232.27 |
MDL | MFCD00070333 |
Boiling point | 300.1±37.0 °C(lit.) |
CAS | 30737-85-0 |
---|---|
Formula | C11H20O5 |
MW | 232.27 |
MDL | MFCD00070333 |
Boiling point | 300.1±37.0 °C(lit.) |
特性 | * |
Smiles | OC[CH]1[CH]([CH]2COC(O2)(C)C)OC(O1)(C)C |
InchiKey | FBIWGPWXTDOFQR-UHFFFAOYSA-N |