Product Name | 6-O-Allyl-1,2:3,4-di-Oisopropylidene-α-D-galactopyranose |
---|---|
CAS | 2771-58-6 |
Formula | C15H24O6 |
MW | 300.35 |
Boiling point | 363.4±37.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 6-O-Allyl-1,2:3,4-di-Oisopropylidene-α-D-galactopyranose |
---|---|
CAS | 2771-58-6 |
Formula | C15H24O6 |
MW | 300.35 |
Boiling point | 363.4±37.0 °C(lit.) |
CAS | 2771-58-6 |
---|---|
Formula | C15H24O6 |
MW | 300.35 |
Boiling point | 363.4±37.0 °C(lit.) |
特性 | * |
Smiles | C([CH]1O[C]2([H])OC(C)(C)O[C]2([H])[C]2([H])OC(C)(C)O[C]12[H])OCC=C |
InchiKey | GEJMFTVJWXRTQJ-UHFFFAOYSA-N |