Product Name | 1,2-O-Isopropylidene-6-O-tosyla-D-allofuranose |
---|---|
CAS | 24384-93-8 |
Formula | C16H22O8S |
MW | 374.41 |
Melting point | 117-119 °C(lit.) |
Boiling point | 568.1±50.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1,2-O-Isopropylidene-6-O-tosyla-D-allofuranose |
---|---|
CAS | 24384-93-8 |
Formula | C16H22O8S |
MW | 374.41 |
Melting point | 117-119 °C(lit.) |
Boiling point | 568.1±50.0 °C(lit.) |
CAS | 24384-93-8 |
---|---|
Formula | C16H22O8S |
MW | 374.41 |
Melting point | 117-119 °C(lit.) |
Boiling point | 568.1±50.0 °C(lit.) |
特性 | * |
Smiles | O[CH]1[C]([H])(O[C]2([H])OC(C)(C)O[C]12[H])[CH](O)COS(C1C=CC(C)=CC=1)(=O)=O |
InchiKey | YOQAMHMOGSSLIX-UHFFFAOYSA-N |