Product Name | (5R,6R,6AR)-5-((R)-1,2-dihydroxyethyl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-6-yl benzoate |
---|---|
CAS | 31795-13-8 |
Formula | C16H20O7 |
MW | 324.326 |
MDL | MFCD07367451 |
Melting point | 95-99 °C(lit.) |
Boiling point | 482.9±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | (5R,6R,6AR)-5-((R)-1,2-dihydroxyethyl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-6-yl benzoate |
---|---|
CAS | 31795-13-8 |
Formula | C16H20O7 |
MW | 324.326 |
MDL | MFCD07367451 |
Melting point | 95-99 °C(lit.) |
Boiling point | 482.9±45.0 °C(lit.) |
CAS | 31795-13-8 |
---|---|
Formula | C16H20O7 |
MW | 324.326 |
MDL | MFCD07367451 |
Melting point | 95-99 °C(lit.) |
Boiling point | 482.9±45.0 °C(lit.) |
特性 | * |
Smiles | CC1(O[CH]2[CH]([CH](OC2O1)[CH](CO)O)OC(=O)C3=CC=CC=C3)C |
InchiKey | FVMGHHSPTSHJCW-UHFFFAOYSA-N |